C10H13N3O — CID 130666257
2-(cyclopropylamino)-N-methylpyridine-4-carboxamide (PubChem CID 130666257) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is 2-(cyclopropylamino)-N-methylpyridine-4-carboxamide.
| Compound Name | 2-(cyclopropylamino)-N-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 130666257 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 2-(cyclopropylamino)-N-methylpyridine-4-carboxamide |
| SMILES | CNC(=O)c1ccnc(NC2CC2)c1 |
| InChI | InChI=1S/C10H13N3O/c1-11-10(14)7-4-5-12-9(6-7)13-8-2-3-8/h4-6,8H,2-3H2,1H3,(H,11,14)(H,12,13) |
| InChIKey | SZCXHCAHLSGIMP-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |