C19H22BrN3O — CID 109166381
N-(2-bromo-4-methylphenyl)-2-(cyclohexylamino)pyridine-4-carboxamide (PubChem CID 109166381) has the molecular formula C19H22BrN3O and a molecular weight of 388.31 g/mol. Its IUPAC name is N-(2-bromo-4-methylphenyl)-2-(cyclohexylamino)pyridine-4-carboxamide.
| Compound Name | N-(2-bromo-4-methylphenyl)-2-(cyclohexylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109166381 |
| Molecular Formula | C19H22BrN3O |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | N-(2-bromo-4-methylphenyl)-2-(cyclohexylamino)pyridine-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccnc(NC3CCCCC3)c2)c(Br)c1 |
| InChI | InChI=1S/C19H22BrN3O/c1-13-7-8-17(16(20)11-13)23-19(24)14-9-10-21-18(12-14)22-15-5-3-2-4-6-15/h7-12,15H,2-6H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | GZKAGRQHBYWOFA-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |