C18H20BrN3O2 — CID 109089325
4-N-(2-bromo-4-methylphenyl)-2-N-tert-butylpyridine-2,4-dicarboxamide (PubChem CID 109089325) has the molecular formula C18H20BrN3O2 and a molecular weight of 390.28 g/mol. Its IUPAC name is 4-N-(2-bromo-4-methylphenyl)-2-N-tert-butylpyridine-2,4-dicarboxamide.
| Compound Name | 4-N-(2-bromo-4-methylphenyl)-2-N-tert-butylpyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109089325 |
| Molecular Formula | C18H20BrN3O2 |
| Molecular Weight | 390.28 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 4-N-(2-bromo-4-methylphenyl)-2-N-tert-butylpyridine-2,4-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccnc(C(=O)NC(C)(C)C)c2)c(Br)c1 |
| InChI | InChI=1S/C18H20BrN3O2/c1-11-5-6-14(13(19)9-11)21-16(23)12-7-8-20-15(10-12)17(24)22-18(2,3)4/h5-10H,1-4H3,(H,21,23)(H,22,24) |
| InChIKey | SJTMWVVCVBNAKS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.28 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |