C21H17F2N3O2 — CID 109091819
2-N-(2,4-difluorophenyl)-4-N-(2,5-dimethylphenyl)pyridine-2,4-dicarboxamide (PubChem CID 109091819) has the molecular formula C21H17F2N3O2 and a molecular weight of 381.38 g/mol. Its IUPAC name is 2-N-(2,4-difluorophenyl)-4-N-(2,5-dimethylphenyl)pyridine-2,4-dicarboxamide.
| Compound Name | 2-N-(2,4-difluorophenyl)-4-N-(2,5-dimethylphenyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109091819 |
| Molecular Formula | C21H17F2N3O2 |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 2-N-(2,4-difluorophenyl)-4-N-(2,5-dimethylphenyl)pyridine-2,4-dicarboxamide |
| SMILES | Cc1ccc(C)c(NC(=O)c2ccnc(C(=O)Nc3ccc(F)cc3F)c2)c1 |
| InChI | InChI=1S/C21H17F2N3O2/c1-12-3-4-13(2)18(9-12)26-20(27)14-7-8-24-19(10-14)21(28)25-17-6-5-15(22)11-16(17)23/h3-11H,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | KLCYYDGLGHQFBO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |