C17H17F2N3O2 — CID 109088871
2-N-(2,4-difluorophenyl)-4-N,4-N-diethylpyridine-2,4-dicarboxamide (PubChem CID 109088871) has the molecular formula C17H17F2N3O2 and a molecular weight of 333.34 g/mol. Its IUPAC name is 2-N-(2,4-difluorophenyl)-4-N,4-N-diethylpyridine-2,4-dicarboxamide.
| Compound Name | 2-N-(2,4-difluorophenyl)-4-N,4-N-diethylpyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109088871 |
| Molecular Formula | C17H17F2N3O2 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 2-N-(2,4-difluorophenyl)-4-N,4-N-diethylpyridine-2,4-dicarboxamide |
| SMILES | CCN(CC)C(=O)c1ccnc(C(=O)Nc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C17H17F2N3O2/c1-3-22(4-2)17(24)11-7-8-20-15(9-11)16(23)21-14-6-5-12(18)10-13(14)19/h5-10H,3-4H2,1-2H3,(H,21,23) |
| InChIKey | BETLNHCLZPGJAF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |