C18H21N3O3 — CID 109082390
4-N-(2,5-dimethylphenyl)-2-N-(2-methoxyethyl)pyridine-2,4-dicarboxamide (PubChem CID 109082390) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 4-N-(2,5-dimethylphenyl)-2-N-(2-methoxyethyl)pyridine-2,4-dicarboxamide.
| Compound Name | 4-N-(2,5-dimethylphenyl)-2-N-(2-methoxyethyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109082390 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 4-N-(2,5-dimethylphenyl)-2-N-(2-methoxyethyl)pyridine-2,4-dicarboxamide |
| SMILES | COCCNC(=O)c1cc(C(=O)Nc2cc(C)ccc2C)ccn1 |
| InChI | InChI=1S/C18H21N3O3/c1-12-4-5-13(2)15(10-12)21-17(22)14-6-7-19-16(11-14)18(23)20-8-9-24-3/h4-7,10-11H,8-9H2,1-3H3,(H,20,23)(H,21,22) |
| InChIKey | LSDCRQQFMPIICI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|