C16H16BrN3O3 — CID 109082277
2-N-(2-bromophenyl)-4-N-(2-methoxyethyl)pyridine-2,4-dicarboxamide (PubChem CID 109082277) has the molecular formula C16H16BrN3O3 and a molecular weight of 378.23 g/mol. Its IUPAC name is 2-N-(2-bromophenyl)-4-N-(2-methoxyethyl)pyridine-2,4-dicarboxamide.
| Compound Name | 2-N-(2-bromophenyl)-4-N-(2-methoxyethyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109082277 |
| Molecular Formula | C16H16BrN3O3 |
| Molecular Weight | 378.23 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | 2-N-(2-bromophenyl)-4-N-(2-methoxyethyl)pyridine-2,4-dicarboxamide |
| SMILES | COCCNC(=O)c1ccnc(C(=O)Nc2ccccc2Br)c1 |
| InChI | InChI=1S/C16H16BrN3O3/c1-23-9-8-19-15(21)11-6-7-18-14(10-11)16(22)20-13-5-3-2-4-12(13)17/h2-7,10H,8-9H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | RSTXPUPJBYODJL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.23 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|