C18H18N4O3 — CID 109082631
2-N-(2-cyanophenyl)-4-N-(3-methoxypropyl)pyridine-2,4-dicarboxamide (PubChem CID 109082631) has the molecular formula C18H18N4O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is 2-N-(2-cyanophenyl)-4-N-(3-methoxypropyl)pyridine-2,4-dicarboxamide.
| Compound Name | 2-N-(2-cyanophenyl)-4-N-(3-methoxypropyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109082631 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 2-N-(2-cyanophenyl)-4-N-(3-methoxypropyl)pyridine-2,4-dicarboxamide |
| SMILES | COCCCNC(=O)c1ccnc(C(=O)Nc2ccccc2C#N)c1 |
| InChI | InChI=1S/C18H18N4O3/c1-25-10-4-8-21-17(23)13-7-9-20-16(11-13)18(24)22-15-6-3-2-5-14(15)12-19/h2-3,5-7,9,11H,4,8,10H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | MOXBVEZKKDJLRZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|