C16H16BrN3O2 — CID 109077777
2-N-(2-bromophenyl)-4-N-propylpyridine-2,4-dicarboxamide (PubChem CID 109077777) has the molecular formula C16H16BrN3O2 and a molecular weight of 362.23 g/mol. Its IUPAC name is 2-N-(2-bromophenyl)-4-N-propylpyridine-2,4-dicarboxamide.
| Compound Name | 2-N-(2-bromophenyl)-4-N-propylpyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109077777 |
| Molecular Formula | C16H16BrN3O2 |
| Molecular Weight | 362.23 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 2-N-(2-bromophenyl)-4-N-propylpyridine-2,4-dicarboxamide |
| SMILES | CCCNC(=O)c1ccnc(C(=O)Nc2ccccc2Br)c1 |
| InChI | InChI=1S/C16H16BrN3O2/c1-2-8-19-15(21)11-7-9-18-14(10-11)16(22)20-13-6-4-3-5-12(13)17/h3-7,9-10H,2,8H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | RRXQXGSYLUONIS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.23 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |