C17H17BrN2O2 — CID 109043031
4-N-(2-bromophenyl)-1-N-propylbenzene-1,4-dicarboxamide (PubChem CID 109043031) has the molecular formula C17H17BrN2O2 and a molecular weight of 361.24 g/mol. Its IUPAC name is 4-N-(2-bromophenyl)-1-N-propylbenzene-1,4-dicarboxamide.
| Compound Name | 4-N-(2-bromophenyl)-1-N-propylbenzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109043031 |
| Molecular Formula | C17H17BrN2O2 |
| Molecular Weight | 361.24 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 4-N-(2-bromophenyl)-1-N-propylbenzene-1,4-dicarboxamide |
| SMILES | CCCNC(=O)c1ccc(C(=O)Nc2ccccc2Br)cc1 |
| InChI | InChI=1S/C17H17BrN2O2/c1-2-11-19-16(21)12-7-9-13(10-8-12)17(22)20-15-6-4-3-5-14(15)18/h3-10H,2,11H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | JOCUNBONUGJGLD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.24 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |