C18H19BrN2O2 — CID 109048442
1-N-(2-bromophenyl)-4-N,4-N-diethylbenzene-1,4-dicarboxamide (PubChem CID 109048442) has the molecular formula C18H19BrN2O2 and a molecular weight of 375.27 g/mol. Its IUPAC name is 1-N-(2-bromophenyl)-4-N,4-N-diethylbenzene-1,4-dicarboxamide.
| Compound Name | 1-N-(2-bromophenyl)-4-N,4-N-diethylbenzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109048442 |
| Molecular Formula | C18H19BrN2O2 |
| Molecular Weight | 375.27 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 1-N-(2-bromophenyl)-4-N,4-N-diethylbenzene-1,4-dicarboxamide |
| SMILES | CCN(CC)C(=O)c1ccc(C(=O)Nc2ccccc2Br)cc1 |
| InChI | InChI=1S/C18H19BrN2O2/c1-3-21(4-2)18(23)14-11-9-13(10-12-14)17(22)20-16-8-6-5-7-15(16)19/h5-12H,3-4H2,1-2H3,(H,20,22) |
| InChIKey | VCHRLDKMGKBPPP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.27 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |