C20H24N4O3 — CID 86835479
2-[[4-[(carbamoylamino)methyl]benzoyl]amino]-N,N-diethylbenzamide (PubChem CID 86835479) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is 2-[[4-[(carbamoylamino)methyl]benzoyl]amino]-N,N-diethylbenzamide.
| Compound Name | 2-[[4-[(carbamoylamino)methyl]benzoyl]amino]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 86835479 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 2-[[4-[(carbamoylamino)methyl]benzoyl]amino]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccccc1NC(=O)c1ccc(CNC(N)=O)cc1 |
| InChI | InChI=1S/C20H24N4O3/c1-3-24(4-2)19(26)16-7-5-6-8-17(16)23-18(25)15-11-9-14(10-12-15)13-22-20(21)27/h5-12H,3-4,13H2,1-2H3,(H,23,25)(H3,21,22,27) |
| InChIKey | OYGUBNGCQWZFJZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |