C22H23N3O3S — CID 86835530
N,N-diethyl-2-[[4-(1,3-thiazol-4-ylmethoxy)benzoyl]amino]benzamide (PubChem CID 86835530) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is N,N-diethyl-2-[[4-(1,3-thiazol-4-ylmethoxy)benzoyl]amino]benzamide.
| Compound Name | N,N-diethyl-2-[[4-(1,3-thiazol-4-ylmethoxy)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 86835530 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | N,N-diethyl-2-[[4-(1,3-thiazol-4-ylmethoxy)benzoyl]amino]benzamide |
| SMILES | CCN(CC)C(=O)c1ccccc1NC(=O)c1ccc(OCc2cscn2)cc1 |
| InChI | InChI=1S/C22H23N3O3S/c1-3-25(4-2)22(27)19-7-5-6-8-20(19)24-21(26)16-9-11-18(12-10-16)28-13-17-14-29-15-23-17/h5-12,14-15H,3-4,13H2,1-2H3,(H,24,26) |
| InChIKey | RAMGQGKOANWYPW-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |