C16H14N2O2S2 — CID 35008943
4-(1,3-thiazol-4-ylmethoxy)-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 35008943) has the molecular formula C16H14N2O2S2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 4-(1,3-thiazol-4-ylmethoxy)-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | 4-(1,3-thiazol-4-ylmethoxy)-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 35008943 |
| Molecular Formula | C16H14N2O2S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 4-(1,3-thiazol-4-ylmethoxy)-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | O=C(NCc1cccs1)c1ccc(OCc2cscn2)cc1 |
| InChI | InChI=1S/C16H14N2O2S2/c19-16(17-8-15-2-1-7-22-15)12-3-5-14(6-4-12)20-9-13-10-21-11-18-13/h1-7,10-11H,8-9H2,(H,17,19) |
| InChIKey | UWYAHNBMAWARBV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |