C14H12F3NO2S — CID 3749251
N-(thiophen-2-ylmethyl)-4-(2,2,2-trifluoroethoxy)benzamide (PubChem CID 3749251) has the molecular formula C14H12F3NO2S and a molecular weight of 315.32 g/mol. Its IUPAC name is N-(thiophen-2-ylmethyl)-4-(2,2,2-trifluoroethoxy)benzamide.
| Compound Name | N-(thiophen-2-ylmethyl)-4-(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 3749251 |
| Molecular Formula | C14H12F3NO2S |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | N-(thiophen-2-ylmethyl)-4-(2,2,2-trifluoroethoxy)benzamide |
| SMILES | O=C(NCc1cccs1)c1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H12F3NO2S/c15-14(16,17)9-20-11-5-3-10(4-6-11)13(19)18-8-12-2-1-7-21-12/h1-7H,8-9H2,(H,18,19) |
| InChIKey | VGMGXJQTEDCHMW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |