C14H13F3N2OS — CID 62165965
4-(methylamino)-N-(thiophen-2-ylmethyl)-3-(trifluoromethyl)benzamide (PubChem CID 62165965) has the molecular formula C14H13F3N2OS and a molecular weight of 314.33 g/mol. Its IUPAC name is 4-(methylamino)-N-(thiophen-2-ylmethyl)-3-(trifluoromethyl)benzamide.
| Compound Name | 4-(methylamino)-N-(thiophen-2-ylmethyl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 62165965 |
| Molecular Formula | C14H13F3N2OS |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 4-(methylamino)-N-(thiophen-2-ylmethyl)-3-(trifluoromethyl)benzamide |
| SMILES | CNc1ccc(C(=O)NCc2cccs2)cc1C(F)(F)F |
| InChI | InChI=1S/C14H13F3N2OS/c1-18-12-5-4-9(7-11(12)14(15,16)17)13(20)19-8-10-3-2-6-21-10/h2-7,18H,8H2,1H3,(H,19,20) |
| InChIKey | TYBCFDZQMNICJV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |