C22H24N2O2S2 — CID 2801009
5-tert-butyl-1-N,3-N-bis(thiophen-2-ylmethyl)benzene-1,3-dicarboxamide (PubChem CID 2801009) has the molecular formula C22H24N2O2S2 and a molecular weight of 412.58 g/mol. Its IUPAC name is 5-tert-butyl-1-N,3-N-bis(thiophen-2-ylmethyl)benzene-1,3-dicarboxamide.
| Compound Name | 5-tert-butyl-1-N,3-N-bis(thiophen-2-ylmethyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 2801009 |
| Molecular Formula | C22H24N2O2S2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 5-tert-butyl-1-N,3-N-bis(thiophen-2-ylmethyl)benzene-1,3-dicarboxamide |
| SMILES | CC(C)(C)c1cc(C(=O)NCc2cccs2)cc(C(=O)NCc2cccs2)c1 |
| InChI | InChI=1S/C22H24N2O2S2/c1-22(2,3)17-11-15(20(25)23-13-18-6-4-8-27-18)10-16(12-17)21(26)24-14-19-7-5-9-28-19/h4-12H,13-14H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | RUMSAZZUOSOHIG-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |