C12H12N2O2S2 — CID 6421749
N,N'-bis(thiophen-2-ylmethyl)oxamide (PubChem CID 6421749) has the molecular formula C12H12N2O2S2 and a molecular weight of 280.37 g/mol. Its IUPAC name is N,N'-bis(thiophen-2-ylmethyl)oxamide.
| Compound Name | N,N'-bis(thiophen-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 6421749 |
| Molecular Formula | C12H12N2O2S2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | N,N'-bis(thiophen-2-ylmethyl)oxamide |
| SMILES | O=C(NCc1cccs1)C(=O)NCc1cccs1 |
| InChI | InChI=1S/C12H12N2O2S2/c15-11(13-7-9-3-1-5-17-9)12(16)14-8-10-4-2-6-18-10/h1-6H,7-8H2,(H,13,15)(H,14,16) |
| InChIKey | NOSYGNWELJYIQH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|