C15H10F6N2O2S — CID 139833843
N'-[3,5-bis(trifluoromethyl)phenyl]-N-(thiophen-2-ylmethyl)oxamide (PubChem CID 139833843) has the molecular formula C15H10F6N2O2S and a molecular weight of 396.31 g/mol. Its IUPAC name is N'-[3,5-bis(trifluoromethyl)phenyl]-N-(thiophen-2-ylmethyl)oxamide.
| Compound Name | N'-[3,5-bis(trifluoromethyl)phenyl]-N-(thiophen-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 139833843 |
| Molecular Formula | C15H10F6N2O2S |
| Molecular Weight | 396.31 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | N'-[3,5-bis(trifluoromethyl)phenyl]-N-(thiophen-2-ylmethyl)oxamide |
| SMILES | O=C(NCc1cccs1)C(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H10F6N2O2S/c16-14(17,18)8-4-9(15(19,20)21)6-10(5-8)23-13(25)12(24)22-7-11-2-1-3-26-11/h1-6H,7H2,(H,22,24)(H,23,25) |
| InChIKey | GAAKIUPICXNPRK-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.31 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|