C19H15F3N2O3S2 — CID 90583751
N-[[5-[hydroxy(thiophen-2-yl)methyl]thiophen-2-yl]methyl]-N'-[3-(trifluoromethyl)phenyl]oxamide (PubChem CID 90583751) has the molecular formula C19H15F3N2O3S2 and a molecular weight of 440.47 g/mol. Its IUPAC name is N-[[5-[hydroxy(thiophen-2-yl)methyl]thiophen-2-yl]methyl]-N'-[3-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N-[[5-[hydroxy(thiophen-2-yl)methyl]thiophen-2-yl]methyl]-N'-[3-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 90583751 |
| Molecular Formula | C19H15F3N2O3S2 |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | N-[[5-[hydroxy(thiophen-2-yl)methyl]thiophen-2-yl]methyl]-N'-[3-(trifluoromethyl)phenyl]oxamide |
| SMILES | O=C(NCc1ccc(C(O)c2cccs2)s1)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H15F3N2O3S2/c20-19(21,22)11-3-1-4-12(9-11)24-18(27)17(26)23-10-13-6-7-15(29-13)16(25)14-5-2-8-28-14/h1-9,16,25H,10H2,(H,23,26)(H,24,27) |
| InChIKey | POLWQWPPLYUDFB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|