C14H14N2O3S2 — CID 97257633
N'-[4-[(S)-methylsulfinyl]phenyl]-N-(thiophen-2-ylmethyl)oxamide (PubChem CID 97257633) has the molecular formula C14H14N2O3S2 and a molecular weight of 322.41 g/mol. Its IUPAC name is N'-[4-[(S)-methylsulfinyl]phenyl]-N-(thiophen-2-ylmethyl)oxamide.
| Compound Name | N'-[4-[(S)-methylsulfinyl]phenyl]-N-(thiophen-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 97257633 |
| Molecular Formula | C14H14N2O3S2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | N'-[4-[(S)-methylsulfinyl]phenyl]-N-(thiophen-2-ylmethyl)oxamide |
| SMILES | C[S@](=O)c1ccc(NC(=O)C(=O)NCc2cccs2)cc1 |
| InChI | InChI=1S/C14H14N2O3S2/c1-21(19)12-6-4-10(5-7-12)16-14(18)13(17)15-9-11-3-2-8-20-11/h2-8H,9H2,1H3,(H,15,17)(H,16,18)/t21-/m0/s1 |
| InChIKey | XSHQVDFDRMZHQT-NRFANRHFSA-N |
| XLogP | 1.74 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|