C13H10F2N2O2S — CID 47457450
N'-(2,3-difluorophenyl)-N-(thiophen-2-ylmethyl)oxamide (PubChem CID 47457450) has the molecular formula C13H10F2N2O2S and a molecular weight of 296.30 g/mol. Its IUPAC name is N'-(2,3-difluorophenyl)-N-(thiophen-2-ylmethyl)oxamide.
| Compound Name | N'-(2,3-difluorophenyl)-N-(thiophen-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 47457450 |
| Molecular Formula | C13H10F2N2O2S |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | N'-(2,3-difluorophenyl)-N-(thiophen-2-ylmethyl)oxamide |
| SMILES | O=C(NCc1cccs1)C(=O)Nc1cccc(F)c1F |
| InChI | InChI=1S/C13H10F2N2O2S/c14-9-4-1-5-10(11(9)15)17-13(19)12(18)16-7-8-3-2-6-20-8/h1-6H,7H2,(H,16,18)(H,17,19) |
| InChIKey | KAKXZBMYKLQLES-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|