C16H14F2N2O3 — CID 86856664
N'-(2,3-difluorophenyl)-N-[(3-methoxyphenyl)methyl]oxamide (PubChem CID 86856664) has the molecular formula C16H14F2N2O3 and a molecular weight of 320.30 g/mol. Its IUPAC name is N'-(2,3-difluorophenyl)-N-[(3-methoxyphenyl)methyl]oxamide.
| Compound Name | N'-(2,3-difluorophenyl)-N-[(3-methoxyphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 86856664 |
| Molecular Formula | C16H14F2N2O3 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | N'-(2,3-difluorophenyl)-N-[(3-methoxyphenyl)methyl]oxamide |
| SMILES | COc1cccc(CNC(=O)C(=O)Nc2cccc(F)c2F)c1 |
| InChI | InChI=1S/C16H14F2N2O3/c1-23-11-5-2-4-10(8-11)9-19-15(21)16(22)20-13-7-3-6-12(17)14(13)18/h2-8H,9H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | ZPLNEJVLMXXGKJ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|