C17H17F2N3O2 — CID 86856678
N'-(2,3-difluorophenyl)-N-[[4-(dimethylamino)phenyl]methyl]oxamide (PubChem CID 86856678) has the molecular formula C17H17F2N3O2 and a molecular weight of 333.34 g/mol. Its IUPAC name is N'-(2,3-difluorophenyl)-N-[[4-(dimethylamino)phenyl]methyl]oxamide.
| Compound Name | N'-(2,3-difluorophenyl)-N-[[4-(dimethylamino)phenyl]methyl]oxamide |
|---|---|
| PubChem CID | 86856678 |
| Molecular Formula | C17H17F2N3O2 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | N'-(2,3-difluorophenyl)-N-[[4-(dimethylamino)phenyl]methyl]oxamide |
| SMILES | CN(C)c1ccc(CNC(=O)C(=O)Nc2cccc(F)c2F)cc1 |
| InChI | InChI=1S/C17H17F2N3O2/c1-22(2)12-8-6-11(7-9-12)10-20-16(23)17(24)21-14-5-3-4-13(18)15(14)19/h3-9H,10H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | NPCZONVTEWHRCD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|