C16H17BrFN3O — CID 51290448
1-(4-bromo-2-fluorophenyl)-3-[[4-(dimethylamino)phenyl]methyl]urea (PubChem CID 51290448) has the molecular formula C16H17BrFN3O and a molecular weight of 366.23 g/mol. Its IUPAC name is 1-(4-bromo-2-fluorophenyl)-3-[[4-(dimethylamino)phenyl]methyl]urea.
| Compound Name | 1-(4-bromo-2-fluorophenyl)-3-[[4-(dimethylamino)phenyl]methyl]urea |
|---|---|
| PubChem CID | 51290448 |
| Molecular Formula | C16H17BrFN3O |
| Molecular Weight | 366.23 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | 1-(4-bromo-2-fluorophenyl)-3-[[4-(dimethylamino)phenyl]methyl]urea |
| SMILES | CN(C)c1ccc(CNC(=O)Nc2ccc(Br)cc2F)cc1 |
| InChI | InChI=1S/C16H17BrFN3O/c1-21(2)13-6-3-11(4-7-13)10-19-16(22)20-15-8-5-12(17)9-14(15)18/h3-9H,10H2,1-2H3,(H2,19,20,22) |
| InChIKey | YCYJJXCTVLUKRI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.23 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|