C17H17Br2FN2O — CID 24588996
N-(4-bromo-2-fluorophenyl)-3-[(4-bromophenyl)methyl-methylamino]propanamide (PubChem CID 24588996) has the molecular formula C17H17Br2FN2O and a molecular weight of 444.14 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-3-[(4-bromophenyl)methyl-methylamino]propanamide.
| Compound Name | N-(4-bromo-2-fluorophenyl)-3-[(4-bromophenyl)methyl-methylamino]propanamide |
|---|---|
| PubChem CID | 24588996 |
| Molecular Formula | C17H17Br2FN2O |
| Molecular Weight | 444.14 g/mol |
| Exact Mass | 441.97 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-3-[(4-bromophenyl)methyl-methylamino]propanamide |
| SMILES | CN(CCC(=O)Nc1ccc(Br)cc1F)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H17Br2FN2O/c1-22(11-12-2-4-13(18)5-3-12)9-8-17(23)21-16-7-6-14(19)10-15(16)20/h2-7,10H,8-9,11H2,1H3,(H,21,23) |
| InChIKey | RMUDARLRHNBYIS-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.14 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |