C18H18BrF3N2O2 — CID 55481998
N-(4-bromo-2-fluorophenyl)-3-[[4-(difluoromethoxy)phenyl]methyl-methylamino]propanamide (PubChem CID 55481998) has the molecular formula C18H18BrF3N2O2 and a molecular weight of 431.25 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-3-[[4-(difluoromethoxy)phenyl]methyl-methylamino]propanamide.
| Compound Name | N-(4-bromo-2-fluorophenyl)-3-[[4-(difluoromethoxy)phenyl]methyl-methylamino]propanamide |
|---|---|
| PubChem CID | 55481998 |
| Molecular Formula | C18H18BrF3N2O2 |
| Molecular Weight | 431.25 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-3-[[4-(difluoromethoxy)phenyl]methyl-methylamino]propanamide |
| SMILES | CN(CCC(=O)Nc1ccc(Br)cc1F)Cc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C18H18BrF3N2O2/c1-24(11-12-2-5-14(6-3-12)26-18(21)22)9-8-17(25)23-16-7-4-13(19)10-15(16)20/h2-7,10,18H,8-9,11H2,1H3,(H,23,25) |
| InChIKey | MOPWIIGPYLZILM-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.25 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |