C16H14BrF3N2O — CID 2698726
2-[(4-bromophenyl)methyl-methylamino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 2698726) has the molecular formula C16H14BrF3N2O and a molecular weight of 387.20 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl-methylamino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[(4-bromophenyl)methyl-methylamino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 2698726 |
| Molecular Formula | C16H14BrF3N2O |
| Molecular Weight | 387.20 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | 2-[(4-bromophenyl)methyl-methylamino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CN(CC(=O)Nc1ccc(F)c(F)c1F)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C16H14BrF3N2O/c1-22(8-10-2-4-11(17)5-3-10)9-14(23)21-13-7-6-12(18)15(19)16(13)20/h2-7H,8-9H2,1H3,(H,21,23) |
| InChIKey | QRKPGMBBBXUSDG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.20 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|