C17H16F4N2OS — CID 8709895
2-[2-(4-fluorophenyl)sulfanylethyl-methylamino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 8709895) has the molecular formula C17H16F4N2OS and a molecular weight of 372.39 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)sulfanylethyl-methylamino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[2-(4-fluorophenyl)sulfanylethyl-methylamino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 8709895 |
| Molecular Formula | C17H16F4N2OS |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 2-[2-(4-fluorophenyl)sulfanylethyl-methylamino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CN(CCSc1ccc(F)cc1)CC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H16F4N2OS/c1-23(8-9-25-12-4-2-11(18)3-5-12)10-15(24)22-14-7-6-13(19)16(20)17(14)21/h2-7H,8-10H2,1H3,(H,22,24) |
| InChIKey | QZHKJAXVYNQQNY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|