C16H16F3N3O — CID 109001471
2-[methyl(2-pyridin-4-ylethyl)amino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 109001471) has the molecular formula C16H16F3N3O and a molecular weight of 323.32 g/mol. Its IUPAC name is 2-[methyl(2-pyridin-4-ylethyl)amino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[methyl(2-pyridin-4-ylethyl)amino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 109001471 |
| Molecular Formula | C16H16F3N3O |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 2-[methyl(2-pyridin-4-ylethyl)amino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CN(CCc1ccncc1)CC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C16H16F3N3O/c1-22(9-6-11-4-7-20-8-5-11)10-14(23)21-13-3-2-12(17)15(18)16(13)19/h2-5,7-8H,6,9-10H2,1H3,(H,21,23) |
| InChIKey | ZCBOIKVNOOFTNE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|