C17H16F3N3O2 — CID 27773073
N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylpyridine-4-carboxamide (PubChem CID 27773073) has the molecular formula C17H16F3N3O2 and a molecular weight of 351.33 g/mol. Its IUPAC name is N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylpyridine-4-carboxamide.
| Compound Name | N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 27773073 |
| Molecular Formula | C17H16F3N3O2 |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylpyridine-4-carboxamide |
| SMILES | CCCN(CC(=O)Nc1ccc(F)c(F)c1F)C(=O)c1ccncc1 |
| InChI | InChI=1S/C17H16F3N3O2/c1-2-9-23(17(25)11-5-7-21-8-6-11)10-14(24)22-13-4-3-12(18)15(19)16(13)20/h3-8H,2,9-10H2,1H3,(H,22,24) |
| InChIKey | ODOZHEUJRYEHIJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|