C21H20F3N5O3 — CID 55499846
N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propyl-3-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)propanamide (PubChem CID 55499846) has the molecular formula C21H20F3N5O3 and a molecular weight of 447.42 g/mol. Its IUPAC name is N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propyl-3-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)propanamide.
| Compound Name | N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propyl-3-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)propanamide |
|---|---|
| PubChem CID | 55499846 |
| Molecular Formula | C21H20F3N5O3 |
| Molecular Weight | 447.42 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propyl-3-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)propanamide |
| SMILES | CCCN(CC(=O)Nc1ccc(F)c(F)c1F)C(=O)CCc1nc(-c2ccncc2)no1 |
| InChI | InChI=1S/C21H20F3N5O3/c1-2-11-29(12-16(30)26-15-4-3-14(22)19(23)20(15)24)18(31)6-5-17-27-21(28-32-17)13-7-9-25-10-8-13/h3-4,7-10H,2,5-6,11-12H2,1H3,(H,26,30) |
| InChIKey | HRSWDTKYXPJUSB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|