C17H13F3N4O3S — CID 27813187
N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)propanamide (PubChem CID 27813187) has the molecular formula C17H13F3N4O3S and a molecular weight of 410.38 g/mol. Its IUPAC name is N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)propanamide.
| Compound Name | N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)propanamide |
|---|---|
| PubChem CID | 27813187 |
| Molecular Formula | C17H13F3N4O3S |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)propanamide |
| SMILES | O=C(CCc1nc(-c2ccsc2)no1)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H13F3N4O3S/c18-10-1-2-11(16(20)15(10)19)22-13(26)7-21-12(25)3-4-14-23-17(24-27-14)9-5-6-28-8-9/h1-2,5-6,8H,3-4,7H2,(H,21,25)(H,22,26) |
| InChIKey | SUAVEFQUPWMVIH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|