C20H16ClF3N4O3 — CID 55648390
4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]butanamide (PubChem CID 55648390) has the molecular formula C20H16ClF3N4O3 and a molecular weight of 452.82 g/mol. Its IUPAC name is 4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]butanamide.
| Compound Name | 4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]butanamide |
|---|---|
| PubChem CID | 55648390 |
| Molecular Formula | C20H16ClF3N4O3 |
| Molecular Weight | 452.82 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | 4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]butanamide |
| SMILES | O=C(CCCc1nc(-c2ccc(Cl)cc2)no1)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C20H16ClF3N4O3/c21-12-6-4-11(5-7-12)20-27-17(31-28-20)3-1-2-15(29)25-10-16(30)26-14-9-8-13(22)18(23)19(14)24/h4-9H,1-3,10H2,(H,25,29)(H,26,30) |
| InChIKey | IOVKCABRJGZHQI-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.82 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|