C18H15ClIN3O2 — CID 39892599
4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-(4-iodophenyl)butanamide (PubChem CID 39892599) has the molecular formula C18H15ClIN3O2 and a molecular weight of 467.69 g/mol. Its IUPAC name is 4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-(4-iodophenyl)butanamide.
| Compound Name | 4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-(4-iodophenyl)butanamide |
|---|---|
| PubChem CID | 39892599 |
| Molecular Formula | C18H15ClIN3O2 |
| Molecular Weight | 467.69 g/mol |
| Exact Mass | 466.99 |
| IUPAC Name | 4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-(4-iodophenyl)butanamide |
| SMILES | O=C(CCCc1nc(-c2ccc(Cl)cc2)no1)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C18H15ClIN3O2/c19-13-6-4-12(5-7-13)18-22-17(25-23-18)3-1-2-16(24)21-15-10-8-14(20)9-11-15/h4-11H,1-3H2,(H,21,24) |
| InChIKey | ZGTGDMIILKFFRU-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.69 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|