C18H14ClFN4O4 — CID 38701413
4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-(4-fluoro-3-nitrophenyl)butanamide (PubChem CID 38701413) has the molecular formula C18H14ClFN4O4 and a molecular weight of 404.79 g/mol. Its IUPAC name is 4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-(4-fluoro-3-nitrophenyl)butanamide.
| Compound Name | 4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-(4-fluoro-3-nitrophenyl)butanamide |
|---|---|
| PubChem CID | 38701413 |
| Molecular Formula | C18H14ClFN4O4 |
| Molecular Weight | 404.79 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-(4-fluoro-3-nitrophenyl)butanamide |
| SMILES | O=C(CCCc1nc(-c2ccc(Cl)cc2)no1)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H14ClFN4O4/c19-12-6-4-11(5-7-12)18-22-17(28-23-18)3-1-2-16(25)21-13-8-9-14(20)15(10-13)24(26)27/h4-10H,1-3H2,(H,21,25) |
| InChIKey | VLSUNSMGPZGYDZ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.79 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|