C19H17ClN4O5 — CID 46480608
4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-[(2-hydroxy-5-nitrophenyl)methyl]butanamide (PubChem CID 46480608) has the molecular formula C19H17ClN4O5 and a molecular weight of 416.82 g/mol. Its IUPAC name is 4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-[(2-hydroxy-5-nitrophenyl)methyl]butanamide.
| Compound Name | 4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-[(2-hydroxy-5-nitrophenyl)methyl]butanamide |
|---|---|
| PubChem CID | 46480608 |
| Molecular Formula | C19H17ClN4O5 |
| Molecular Weight | 416.82 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-[(2-hydroxy-5-nitrophenyl)methyl]butanamide |
| SMILES | O=C(CCCc1nc(-c2ccc(Cl)cc2)no1)NCc1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C19H17ClN4O5/c20-14-6-4-12(5-7-14)19-22-18(29-23-19)3-1-2-17(26)21-11-13-10-15(24(27)28)8-9-16(13)25/h4-10,25H,1-3,11H2,(H,21,26) |
| InChIKey | CDHGWGBJBORGJO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.82 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|