C11H8ClN2NaO3 — CID 162665177
sodium 3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]propanoate (PubChem CID 162665177) has the molecular formula C11H8ClN2NaO3 and a molecular weight of 274.64 g/mol. Its IUPAC name is sodium 3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]propanoate.
| Compound Name | sodium 3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]propanoate |
|---|---|
| PubChem CID | 162665177 |
| Molecular Formula | C11H8ClN2NaO3 |
| Molecular Weight | 274.64 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | sodium 3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]propanoate |
| SMILES | O=C([O-])CCc1nc(-c2ccc(Cl)cc2)no1.[Na+] |
| InChI | InChI=1S/C11H9ClN2O3.Na/c12-8-3-1-7(2-4-8)11-13-9(17-14-11)5-6-10(15)16;/h1-4H,5-6H2,(H,15,16);/q;+1/p-1 |
| InChIKey | WGOHRNNSZYDHJU-UHFFFAOYSA-M |
| XLogP | -1.92 |
| TPSA | 79.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.64 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |