C12H8F3N2O3- — CID 6927988
3-[3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]propanoate (PubChem CID 6927988) has the molecular formula C12H8F3N2O3- and a molecular weight of 285.20 g/mol. Its IUPAC name is 3-[3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]propanoate.
| Compound Name | 3-[3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]propanoate |
|---|---|
| PubChem CID | 6927988 |
| Molecular Formula | C12H8F3N2O3- |
| Molecular Weight | 285.20 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 3-[3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]propanoate |
| SMILES | O=C([O-])CCc1nc(-c2ccc(C(F)(F)F)cc2)no1 |
| InChI | InChI=1S/C12H9F3N2O3/c13-12(14,15)8-3-1-7(2-4-8)11-16-9(20-17-11)5-6-10(18)19/h1-4H,5-6H2,(H,18,19)/p-1 |
| InChIKey | AWTISKOMLIUEOR-UHFFFAOYSA-M |
| XLogP | 1.44 |
| TPSA | 79.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.20 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |