C21H20Cl2N4O3 — CID 46441965
2-chloro-N-[2-[4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]butanoylamino]ethyl]benzamide (PubChem CID 46441965) has the molecular formula C21H20Cl2N4O3 and a molecular weight of 447.32 g/mol. Its IUPAC name is 2-chloro-N-[2-[4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]butanoylamino]ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]butanoylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 46441965 |
| Molecular Formula | C21H20Cl2N4O3 |
| Molecular Weight | 447.32 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | 2-chloro-N-[2-[4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]butanoylamino]ethyl]benzamide |
| SMILES | O=C(CCCc1nc(-c2ccc(Cl)cc2)no1)NCCNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C21H20Cl2N4O3/c22-15-10-8-14(9-11-15)20-26-19(30-27-20)7-3-6-18(28)24-12-13-25-21(29)16-4-1-2-5-17(16)23/h1-2,4-5,8-11H,3,6-7,12-13H2,(H,24,28)(H,25,29) |
| InChIKey | RJJFHAHWGGBSBB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.32 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|