C22H21ClN6O3 — CID 20819137
4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-[2-[(4-oxo-3H-phthalazin-1-yl)amino]ethyl]butanamide (PubChem CID 20819137) has the molecular formula C22H21ClN6O3 and a molecular weight of 452.90 g/mol. Its IUPAC name is 4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-[2-[(4-oxo-3H-phthalazin-1-yl)amino]ethyl]butanamide.
| Compound Name | 4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-[2-[(4-oxo-3H-phthalazin-1-yl)amino]ethyl]butanamide |
|---|---|
| PubChem CID | 20819137 |
| Molecular Formula | C22H21ClN6O3 |
| Molecular Weight | 452.90 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-[2-[(4-oxo-3H-phthalazin-1-yl)amino]ethyl]butanamide |
| SMILES | O=C(CCCc1nc(-c2ccc(Cl)cc2)no1)NCCNc1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C22H21ClN6O3/c23-15-10-8-14(9-11-15)20-26-19(32-29-20)7-3-6-18(30)24-12-13-25-21-16-4-1-2-5-17(16)22(31)28-27-21/h1-2,4-5,8-11H,3,6-7,12-13H2,(H,24,30)(H,25,27)(H,28,31) |
| InChIKey | SQCYERZLHTVQAC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 125.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.90 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|