C23H23FN6O3 — CID 20818956
3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-[4-[(4-oxo-3H-phthalazin-1-yl)amino]butyl]propanamide (PubChem CID 20818956) has the molecular formula C23H23FN6O3 and a molecular weight of 450.47 g/mol. Its IUPAC name is 3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-[4-[(4-oxo-3H-phthalazin-1-yl)amino]butyl]propanamide.
| Compound Name | 3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-[4-[(4-oxo-3H-phthalazin-1-yl)amino]butyl]propanamide |
|---|---|
| PubChem CID | 20818956 |
| Molecular Formula | C23H23FN6O3 |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-[4-[(4-oxo-3H-phthalazin-1-yl)amino]butyl]propanamide |
| SMILES | O=C(CCc1nc(-c2ccc(F)cc2)no1)NCCCCNc1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C23H23FN6O3/c24-16-9-7-15(8-10-16)21-27-20(33-30-21)12-11-19(31)25-13-3-4-14-26-22-17-5-1-2-6-18(17)23(32)29-28-22/h1-2,5-10H,3-4,11-14H2,(H,25,31)(H,26,28)(H,29,32) |
| InChIKey | NMAURQDLMAJBCS-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 125.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|