C23H22ClFN6O3 — CID 20818911
3-[3-[(2-chloro-4-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]-N-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]propanamide (PubChem CID 20818911) has the molecular formula C23H22ClFN6O3 and a molecular weight of 484.92 g/mol. Its IUPAC name is 3-[3-[(2-chloro-4-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]-N-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]propanamide.
| Compound Name | 3-[3-[(2-chloro-4-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]-N-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]propanamide |
|---|---|
| PubChem CID | 20818911 |
| Molecular Formula | C23H22ClFN6O3 |
| Molecular Weight | 484.92 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 3-[3-[(2-chloro-4-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]-N-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]propanamide |
| SMILES | O=C(CCc1nc(Cc2ccc(F)cc2Cl)no1)NCCCNc1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C23H22ClFN6O3/c24-18-13-15(25)7-6-14(18)12-19-28-21(34-31-19)9-8-20(32)26-10-3-11-27-22-16-4-1-2-5-17(16)23(33)30-29-22/h1-2,4-7,13H,3,8-12H2,(H,26,32)(H,27,29)(H,30,33) |
| InChIKey | FWLJYBUHKQRRDE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 125.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.92 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|