C21H20N6O3 — CID 20819375
N-[2-[(4-oxo-3H-phthalazin-1-yl)amino]ethyl]-3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanamide (PubChem CID 20819375) has the molecular formula C21H20N6O3 and a molecular weight of 404.43 g/mol. Its IUPAC name is N-[2-[(4-oxo-3H-phthalazin-1-yl)amino]ethyl]-3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanamide.
| Compound Name | N-[2-[(4-oxo-3H-phthalazin-1-yl)amino]ethyl]-3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanamide |
|---|---|
| PubChem CID | 20819375 |
| Molecular Formula | C21H20N6O3 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | N-[2-[(4-oxo-3H-phthalazin-1-yl)amino]ethyl]-3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanamide |
| SMILES | O=C(CCc1nc(-c2ccccc2)no1)NCCNc1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C21H20N6O3/c28-17(10-11-18-24-19(27-30-18)14-6-2-1-3-7-14)22-12-13-23-20-15-8-4-5-9-16(15)21(29)26-25-20/h1-9H,10-13H2,(H,22,28)(H,23,25)(H,26,29) |
| InChIKey | KZYLNBFKCAUEDO-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 125.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|