C22H21N7O5 — CID 20819290
4-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]-N-[2-[(4-oxo-3H-phthalazin-1-yl)amino]ethyl]butanamide (PubChem CID 20819290) has the molecular formula C22H21N7O5 and a molecular weight of 463.45 g/mol. Its IUPAC name is 4-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]-N-[2-[(4-oxo-3H-phthalazin-1-yl)amino]ethyl]butanamide.
| Compound Name | 4-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]-N-[2-[(4-oxo-3H-phthalazin-1-yl)amino]ethyl]butanamide |
|---|---|
| PubChem CID | 20819290 |
| Molecular Formula | C22H21N7O5 |
| Molecular Weight | 463.45 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 4-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]-N-[2-[(4-oxo-3H-phthalazin-1-yl)amino]ethyl]butanamide |
| SMILES | O=C(CCCc1nc(-c2cccc([N+](=O)[O-])c2)no1)NCCNc1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C22H21N7O5/c30-18(23-11-12-24-21-16-7-1-2-8-17(16)22(31)27-26-21)9-4-10-19-25-20(28-34-19)14-5-3-6-15(13-14)29(32)33/h1-3,5-8,13H,4,9-12H2,(H,23,30)(H,24,26)(H,27,31) |
| InChIKey | SFFQQEGTDVZYRB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 168.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.45 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|