C23H23N7O6 — CID 22343350
3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-[3-[(8-nitro-4-oxo-3H-phthalazin-1-yl)amino]propyl]propanamide (PubChem CID 22343350) has the molecular formula C23H23N7O6 and a molecular weight of 493.48 g/mol. Its IUPAC name is 3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-[3-[(8-nitro-4-oxo-3H-phthalazin-1-yl)amino]propyl]propanamide.
| Compound Name | 3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-[3-[(8-nitro-4-oxo-3H-phthalazin-1-yl)amino]propyl]propanamide |
|---|---|
| PubChem CID | 22343350 |
| Molecular Formula | C23H23N7O6 |
| Molecular Weight | 493.48 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | 3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-[3-[(8-nitro-4-oxo-3H-phthalazin-1-yl)amino]propyl]propanamide |
| SMILES | COc1ccc(-c2noc(CCC(=O)NCCCNc3n[nH]c(=O)c4cccc([N+](=O)[O-])c34)n2)cc1 |
| InChI | InChI=1S/C23H23N7O6/c1-35-15-8-6-14(7-9-15)21-26-19(36-29-21)11-10-18(31)24-12-3-13-25-22-20-16(23(32)28-27-22)4-2-5-17(20)30(33)34/h2,4-9H,3,10-13H2,1H3,(H,24,31)(H,25,27)(H,28,32) |
| InChIKey | GAPBYDJTPSSINT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 178.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.48 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|