C17H13Cl2N3O2 — CID 110323319
2,4-dichloro-N-[2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethyl]benzamide (PubChem CID 110323319) has the molecular formula C17H13Cl2N3O2 and a molecular weight of 362.22 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 110323319 |
| Molecular Formula | C17H13Cl2N3O2 |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 2,4-dichloro-N-[2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethyl]benzamide |
| SMILES | O=C(NCCc1nc(-c2ccccc2)no1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H13Cl2N3O2/c18-12-6-7-13(14(19)10-12)17(23)20-9-8-15-21-16(22-24-15)11-4-2-1-3-5-11/h1-7,10H,8-9H2,(H,20,23) |
| InChIKey | LNGJOSMNNZBWMR-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |