C16H11ClN4O4 — CID 8836733
2-chloro-4-nitro-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]benzamide (PubChem CID 8836733) has the molecular formula C16H11ClN4O4 and a molecular weight of 358.74 g/mol. Its IUPAC name is 2-chloro-4-nitro-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]benzamide.
| Compound Name | 2-chloro-4-nitro-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]benzamide |
|---|---|
| PubChem CID | 8836733 |
| Molecular Formula | C16H11ClN4O4 |
| Molecular Weight | 358.74 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | 2-chloro-4-nitro-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]benzamide |
| SMILES | O=C(NCc1nc(-c2ccccc2)no1)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C16H11ClN4O4/c17-13-8-11(21(23)24)6-7-12(13)16(22)18-9-14-19-15(20-25-14)10-4-2-1-3-5-10/h1-8H,9H2,(H,18,22) |
| InChIKey | IIJJBKPUWSOCPZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.74 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|