C18H14ClN5O5 — CID 17083190
N-[2-[(2-chloro-5-nitrobenzoyl)amino]ethyl]-3-phenyl-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17083190) has the molecular formula C18H14ClN5O5 and a molecular weight of 415.79 g/mol. Its IUPAC name is N-[2-[(2-chloro-5-nitrobenzoyl)amino]ethyl]-3-phenyl-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-[2-[(2-chloro-5-nitrobenzoyl)amino]ethyl]-3-phenyl-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17083190 |
| Molecular Formula | C18H14ClN5O5 |
| Molecular Weight | 415.79 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | N-[2-[(2-chloro-5-nitrobenzoyl)amino]ethyl]-3-phenyl-1,2,4-oxadiazole-5-carboxamide |
| SMILES | O=C(NCCNC(=O)c1cc([N+](=O)[O-])ccc1Cl)c1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C18H14ClN5O5/c19-14-7-6-12(24(27)28)10-13(14)16(25)20-8-9-21-17(26)18-22-15(23-29-18)11-4-2-1-3-5-11/h1-7,10H,8-9H2,(H,20,25)(H,21,26) |
| InChIKey | AHJASSSQVVAYSS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.79 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|