C20H18ClN5O7 — CID 17083976
N-[2-[(2-chloro-4-nitrobenzoyl)amino]ethyl]-3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17083976) has the molecular formula C20H18ClN5O7 and a molecular weight of 475.85 g/mol. Its IUPAC name is N-[2-[(2-chloro-4-nitrobenzoyl)amino]ethyl]-3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-[2-[(2-chloro-4-nitrobenzoyl)amino]ethyl]-3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17083976 |
| Molecular Formula | C20H18ClN5O7 |
| Molecular Weight | 475.85 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | N-[2-[(2-chloro-4-nitrobenzoyl)amino]ethyl]-3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazole-5-carboxamide |
| SMILES | COc1ccc(-c2noc(C(=O)NCCNC(=O)c3ccc([N+](=O)[O-])cc3Cl)n2)cc1OC |
| InChI | InChI=1S/C20H18ClN5O7/c1-31-15-6-3-11(9-16(15)32-2)17-24-20(33-25-17)19(28)23-8-7-22-18(27)13-5-4-12(26(29)30)10-14(13)21/h3-6,9-10H,7-8H2,1-2H3,(H,22,27)(H,23,28) |
| InChIKey | AQGYBCWQOXJIML-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 158.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.85 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|